5,6-Dibromo-1,1,3,3-tetramethylisoindoline, 98%
cas: 221368-76-9 — see every product listed under this CAS number, including other names
5,6-Dibromo-1,1,3,3-tetramethylisoindoline, 98% (CAS 221368-76-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A930851-250mg |
| cas | 221368-76-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1427.25 Pln | |
| Ambeed | 1g | 4147.31 Pln | |
| BLDpharm | 50mg | 408.77 Pln | |
| BLDpharm | 100mg | 708.66 Pln | |
| BLDpharm | 250mg | 1536.15 Pln | |
| BLDpharm | 1g | 4468.45 Pln | |
| Chemat | 50mg | 434.00 Pln | |
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1514.00 Pln | |
| Chemat | 1g | 4422.80 Pln | |
| Fluorochem | 50mg | 789.32 Pln | |
| Fluorochem | 100mg | 1278.73 Pln | |
| Fluorochem | 250mg | 2809.45 Pln | |
| Fluorochem | 1g | 8052.39 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
5,6-dibromo-1,1,3,3-tetramethyl-2H-isoindole (CAS 221368-76-9) is a chemical compound with the molecular formula C12H15Br2N and a molecular weight of 333.06 g/mol. IUPAC name: 5,6-dibromo-1,1,3,3-tetramethyl-2H-isoindole. InChIKey: DHTCCDMFOWGOJW-UHFFFAOYSA-N.
| Molecular formula | C12H15Br2N |
|---|---|
| Molecular weight | 333.06 g/mol |
| IUPAC name | 5,6-dibromo-1,1,3,3-tetramethyl-2H-isoindole |
| InChIKey | DHTCCDMFOWGOJW-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=C(C=C2C(N1)(C)C)Br)Br)C |
Computed by PubChem (NCBI)
Synonyms:
5,6-dibromo-1,1,3,3-tetramethylisoindoline, 5,6-dibromo-1,1,3,3-tetramethyl-2H-isoindole, 56-DibroMo-1133-tetraMethylisoindoline, 1H-isoindole, 5,6-dibromo-2,3-dihydro-1,1,3,3-tetramethyl-, 5,6-dibromo-1,1,3,3-tetramethyl-isoindoline, InChI=1/C12H15Br2N/c1-11(2)7-5-9(13)10(14)6-8(7)12(3,4)15-11/h5-6,15H,1-4H