5,6-Dibromo-1H-indene, 95%
cas: 1802004-76-7 — see every product listed under this CAS number, including other names
5,6-Dibromo-1H-indene, 95% (CAS 1802004-76-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865378-100MG |
| cas | 1802004-76-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 1g | 1231.88 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 915.50 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 846.80 Pln | |
| BLDpharm | 100mg | 292.14 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 914.15 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5,6-dibromo-1H-indene (CAS 1802004-76-7) is a chemical compound with the molecular formula C9H6Br2 and a molecular weight of 273.95 g/mol. IUPAC name: 5,6-dibromo-1H-indene. InChIKey: ZKNIBHOXVMZFSA-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2 |
|---|---|
| Molecular weight | 273.95 g/mol |
| IUPAC name | 5,6-dibromo-1H-indene |
| InChIKey | ZKNIBHOXVMZFSA-UHFFFAOYSA-N |
| SMILES | C1C=CC2=CC(=C(C=C21)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
5,6-dibromo-1H-indene, 1H-Indene, 5,6-dibromo-