cas: 1613439-69-2 — see every product listed under this CAS number, including other names
5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 1-(4-cycloocten-1-yl) 17-(2,5-dioxo-1-pyrrolidinyl) ester, 95%, 95% (CAS 1613439-69-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYNY-50mg |
| cas | 1613439-69-2 |
| size | 50mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 448.40 Pln | |
| Chemat | 100mg | 592.40 Pln | |
| Chemat | 250mg | 1312.40 Pln | |
| Chemat | 1g | 4072.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1613439-69-2) is a chemical compound with the molecular formula C24H38N2O10 and a molecular weight of 514.6 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZKPMRASGLDBKPF-UPHRSURJSA-N.
| Molecular formula | C24H38N2O10 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[(4Z)-cyclooct-4-en-1-yl]oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZKPMRASGLDBKPF-UPHRSURJSA-N |
| SMILES | C1C/C=C\CCC(C1)OC(=O)NCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)