cas: 286456-42-6 — see every product listed under this CAS number, including other names
5-({[7-tert-butyl-3-(2,5-difluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]oxy}methyl)-1-methyl-1,2,4-triazole, 98%, 98% (CAS 286456-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VZ6-1mg |
| cas | 286456-42-6 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 582.80 Pln | |
| Chemat | 100mg | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-tert-butyl-3-(2,5-difluorophenyl)-6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-[1,2,4]triazolo[4,3-b]pyridazine (CAS 286456-42-6) is a chemical compound with the molecular formula C19H19F2N7O and a molecular weight of 399.4 g/mol. IUPAC name: 7-tert-butyl-3-(2,5-difluorophenyl)-6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: BQDUNOMMYOKHEP-UHFFFAOYSA-N.
| Molecular formula | C19H19F2N7O |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 7-tert-butyl-3-(2,5-difluorophenyl)-6-[(2-methyl-1,2,4-triazol-3-yl)methoxy]-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | BQDUNOMMYOKHEP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=NN=C(N2N=C1OCC3=NC=NN3C)C4=C(C=CC(=C4)F)F |
Computed by PubChem (NCBI)