cas: 2203-14-7 — see every product listed under this CAS number, including other names
5-(1,1-Dimethylethyl)-2-hydroxy-1,3-benzenedimethanol, 95%, 95% (CAS 2203-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BL81-100mg |
| cas | 2203-14-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-tert-butyl-2,6-bis(hydroxymethyl)phenol (CAS 2203-14-7) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: 4-tert-butyl-2,6-bis(hydroxymethyl)phenol. InChIKey: SIBBGGADHQDMHI-UHFFFAOYSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 4-tert-butyl-2,6-bis(hydroxymethyl)phenol |
| InChIKey | SIBBGGADHQDMHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)CO)O)CO |
Computed by PubChem (NCBI)