cas: 306934-71-4 — see every product listed under this CAS number, including other names
5-(1,4-Diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole, 97% (CAS 306934-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | AW00426CB |
| cas | 306934-71-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 302.90 Pln | |
| Thermo Scientific | 1g | 565.08 Pln | |
| Thermo Scientific | 5g | 2117.77 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole (CAS 306934-71-4) is a chemical compound with the molecular formula C13H16N4S and a molecular weight of 260.36 g/mol. IUPAC name: 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole. InChIKey: IENGAZSTLAONAR-UHFFFAOYSA-N.
| Molecular formula | C13H16N4S |
|---|---|
| Molecular weight | 260.36 g/mol |
| IUPAC name | 5-(1,4-diazepan-1-yl)-3-phenyl-1,2,4-thiadiazole |
| InChIKey | IENGAZSTLAONAR-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C2=NC(=NS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)