cas: 1218790-44-3 — see every product listed under this CAS number, including other names
5-(1-Piperidinylmethyl)thiophene-2-boronic acid pinacol ester, 99%(GC-MS),RG, 99%(GC-MS),RG (CAS 1218790-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11279J-100mg |
| cas | 1218790-44-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 2690.00 Pln | |
| Chemat | 25g | 12669.20 Pln |
| purity | 99%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine (CAS 1218790-44-3) is a chemical compound with the molecular formula C16H26BNO2S and a molecular weight of 307.3 g/mol. IUPAC name: 1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine. InChIKey: KDPVLCCGXRCQCV-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2S |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | 1-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methyl]piperidine |
| InChIKey | KDPVLCCGXRCQCV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CN3CCCCC3 |
Computed by PubChem (NCBI)