cas: 114413-97-7 — see every product listed under this CAS number, including other names
5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (CAS 114413-97-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DHMY-2mg |
| cas | 114413-97-7 |
| size | 2mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2mg | 131.60 Pln | |
| Chemat | 5mg | 170.00 Pln | |
| Chemat | 10mg | 227.60 Pln | |
| Chemat | 25mg | 357.20 Pln | |
| Chemat | 50mg | 506.00 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 200mg | 1072.40 Pln |
| delivery time | 3 weeks |
|---|
5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide (CAS 114413-97-7) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide. InChIKey: YJMCJQKGIPBLRJ-UHFFFAOYSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanamide |
| InChIKey | YJMCJQKGIPBLRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCCCC(C)(C)C(=O)N |
Computed by PubChem (NCBI)