cas: 41019-43-6 — see every product listed under this CAS number, including other names
5-(2-Chloro-phenyl)-furan-2-carboxylic acid, 95% (CAS 41019-43-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027548-100MG |
| cas | 41019-43-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1143.37 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-(2-chlorophenyl)furan-2-carboxylic acid (CAS 41019-43-6) is a chemical compound with the molecular formula C11H7ClO3 and a molecular weight of 222.62 g/mol. IUPAC name: 5-(2-chlorophenyl)furan-2-carboxylic acid. InChIKey: PJGGWIHXGHQXMM-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO3 |
|---|---|
| Molecular weight | 222.62 g/mol |
| IUPAC name | 5-(2-chlorophenyl)furan-2-carboxylic acid |
| InChIKey | PJGGWIHXGHQXMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C(=O)O)Cl |
Computed by PubChem (NCBI)