cas: 353761-02-1 — see every product listed under this CAS number, including other names
5-(2-Fluoro-phenyl)-furan-2-carboxylic acid, 98% (CAS 353761-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F031909-100MG |
| cas | 353761-02-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 500mg | 830.98 Pln | |
| Fluorochem | 1g | 1013.20 Pln | |
| Fluorochem | 2.5g | 2444.99 Pln | |
| Fluorochem | 5g | 4829.57 Pln | |
| Fluorochem | 10g | 9603.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(2-fluorophenyl)furan-2-carboxylic acid (CAS 353761-02-1) is a chemical compound with the molecular formula C11H7FO3 and a molecular weight of 206.17 g/mol. IUPAC name: 5-(2-fluorophenyl)furan-2-carboxylic acid. InChIKey: GRMHOKHCKXBRIB-UHFFFAOYSA-N.
| Molecular formula | C11H7FO3 |
|---|---|
| Molecular weight | 206.17 g/mol |
| IUPAC name | 5-(2-fluorophenyl)furan-2-carboxylic acid |
| InChIKey | GRMHOKHCKXBRIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C(=O)O)F |
Computed by PubChem (NCBI)