cas: 18029-54-4 — see every product listed under this CAS number, including other names
5-(3-(Dimethylamino)propyl)-5H-dibenzo[a,d][7]annulen-5-ol, 97% (CAS 18029-54-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F340221-50MG |
| cas | 18029-54-4 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 695.61 Pln | |
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 1g | 4111.07 Pln | |
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1243.69 Pln | |
| Ambeed | 1g | 2851.25 Pln | |
| Ambeed | 5g | 6934.12 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol (CAS 18029-54-4) is a chemical compound with the molecular formula C20H23NO and a molecular weight of 293.4 g/mol. IUPAC name: 2-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol. InChIKey: VMLRQKQUOMJJAN-UHFFFAOYSA-N.
| Molecular formula | C20H23NO |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 2-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-ol |
| InChIKey | VMLRQKQUOMJJAN-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=CC=CC=C2C=CC3=CC=CC=C31)O |
Computed by PubChem (NCBI)