cas: 1220219-14-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile 98% (CAS 1220219-14-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A157817-100mg |
| cas | 1220219-14-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 642.94 Pln | |
| Ambeed | 250mg | 904.38 Pln | |
| Ambeed | 1g | 2117.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A157817 |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile (CAS 1220219-14-6) is a chemical compound with the molecular formula C14H15BF3NO2 and a molecular weight of 297.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile. InChIKey: IUORZQUIVDCXJO-UHFFFAOYSA-N.
| Molecular formula | C14H15BF3NO2 |
|---|---|
| Molecular weight | 297.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzonitrile |
| InChIKey | IUORZQUIVDCXJO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)