cas: 916454-59-6 — see every product listed under this CAS number, including other names
5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile, 98%, 98% (CAS 916454-59-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GYEM-50mg |
| cas | 916454-59-6 |
| size | 50mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 530.00 Pln | |
| Chemat | 100mg | 861.20 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 3630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile (CAS 916454-59-6) is a chemical compound with the molecular formula C11H14BNO2S and a molecular weight of 235.11 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile. InChIKey: OXYRAUHWTSONAV-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO2S |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbonitrile |
| InChIKey | OXYRAUHWTSONAV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C#N |
Computed by PubChem (NCBI)