cas: 193542-65-3 — see every product listed under this CAS number, including other names
5-(4-(4-Chlorophenyl)-4-hydroxypiperidin-1-yl)-2,2-diphenylpentanenitrile, 95%, 95% (CAS 193542-65-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OML-100mg |
| cas | 193542-65-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1994.00 Pln | |
| Chemat | 250mg | 3165.20 Pln | |
| Chemat | 1g | 6952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile;hydrochloride (CAS 193542-65-3) is a chemical compound with the molecular formula C28H30Cl2N2O and a molecular weight of 481.5 g/mol. IUPAC name: 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile;hydrochloride. InChIKey: SSZWNUGWOGONQJ-UHFFFAOYSA-N.
| Molecular formula | C28H30Cl2N2O |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | 5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentanenitrile;hydrochloride |
| InChIKey | SSZWNUGWOGONQJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(C#N)(C3=CC=CC=C3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)