cas: 52063-43-1 — see every product listed under this CAS number, including other names
5-(4-Bromophenyl)-3-methylisoxazole, >95%, >95% (CAS 52063-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0B9-100mg |
| cas | 52063-43-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 5g | 4130.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
5-(4-bromophenyl)-3-methyl-1,2-oxazole (CAS 52063-43-1) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-(4-bromophenyl)-3-methyl-1,2-oxazole. InChIKey: AKCVUKKYCZTWKS-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3-methyl-1,2-oxazole |
| InChIKey | AKCVUKKYCZTWKS-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)