CAS 1094322-52-7 appears in our catalog under these names: 5-(4-Chloro-2-fluorophenyl)furan-2-carboxylic acid, 98%, 98%, 5-(4-CHLORO-2-FLUOROPHENYL)FURAN-2-CARBOXYLIC ACID, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-(4-chloro-2-fluorophenyl)furan-2-carboxylic acid (CAS 1094322-52-7) is a chemical compound with the molecular formula C11H6ClFO3 and a molecular weight of 240.61 g/mol. IUPAC name: 5-(4-chloro-2-fluorophenyl)furan-2-carboxylic acid. InChIKey: DDSUPMVULCGCNB-UHFFFAOYSA-N.
| Molecular formula | C11H6ClFO3 |
|---|---|
| Molecular weight | 240.61 g/mol |
| IUPAC name | 5-(4-chloro-2-fluorophenyl)furan-2-carboxylic acid |
| InChIKey | DDSUPMVULCGCNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)