cas: 73963-42-5 — see every product listed under this CAS number, including other names
5-(4-Chlorobutyl)-1-cyclohexyl tetrazole, 98% (CAS 73963-42-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050504-5G |
| cas | 73963-42-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 716.43 Pln | |
| Fluorochem | 500g | 2309.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-chlorobutyl)-1-cyclohexyltetrazole (CAS 73963-42-5) is a chemical compound with the molecular formula C11H19ClN4 and a molecular weight of 242.75 g/mol. IUPAC name: 5-(4-chlorobutyl)-1-cyclohexyltetrazole. InChIKey: INTQSGGUSUSCTJ-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN4 |
|---|---|
| Molecular weight | 242.75 g/mol |
| IUPAC name | 5-(4-chlorobutyl)-1-cyclohexyltetrazole |
| InChIKey | INTQSGGUSUSCTJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C(=NN=N2)CCCCCl |
Computed by PubChem (NCBI)