cas: 381684-96-4 — see every product listed under this CAS number, including other names
5-(4-Fluorophenyl)nicotinaldehyde, 97%, 97% (CAS 381684-96-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXKL-25g |
| cas | 381684-96-4 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 2848.40 Pln | |
| Chemat | 100g | 7955.60 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 899.60 Pln | |
| Chemat | 10g | 1456.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-fluorophenyl)pyridine-3-carbaldehyde (CAS 381684-96-4) is a chemical compound with the molecular formula C12H8FNO and a molecular weight of 201.20 g/mol. IUPAC name: 5-(4-fluorophenyl)pyridine-3-carbaldehyde. InChIKey: LGBCBWOHFSIXOW-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 5-(4-fluorophenyl)pyridine-3-carbaldehyde |
| InChIKey | LGBCBWOHFSIXOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=C2)C=O)F |
Computed by PubChem (NCBI)