CAS 306937-21-3 appears in our catalog under these names: 5-(5-Chloro-1,2,4-thiadiazol-3-yl)thiophene-2-sulfonyl chloride, 95%, 5-(5-Chloro-1,2,4-thiadiazol-3-yl)thiophene-2-sulfonyl chloride, 95% . Offered by: Combi-blocks, Thermo Scientific, Ambeed. Available pack sizes: 500mg, 250mg, 100mg.
5-(5-chloro-1,2,4-thiadiazol-3-yl)thiophene-2-sulfonyl chloride (CAS 306937-21-3) is a chemical compound with the molecular formula C6H2Cl2N2O2S3 and a molecular weight of 301.2 g/mol. IUPAC name: 5-(5-chloro-1,2,4-thiadiazol-3-yl)thiophene-2-sulfonyl chloride. InChIKey: DCLCBWFFYZNVES-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2O2S3 |
|---|---|
| Molecular weight | 301.2 g/mol |
| IUPAC name | 5-(5-chloro-1,2,4-thiadiazol-3-yl)thiophene-2-sulfonyl chloride |
| InChIKey | DCLCBWFFYZNVES-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)C2=NSC(=N2)Cl |
Computed by PubChem (NCBI)