cas: 2034157-65-6 — see every product listed under this CAS number, including other names
5-(Aminomethyl)-1-(2-methoxyethyl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride, 95% (CAS 2034157-65-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A869393-5g |
| cas | 2034157-65-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 34006.63 Pln | |
| AmBeed | 1g | 11410.42 Pln | |
| AmBeed | 10g | 47547.43 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(aminomethyl)-1-(2-methoxyethyl)pyrimidine-2,4-dione;hydrochloride (CAS 2034157-65-6) is a chemical compound with the molecular formula C8H14ClN3O3 and a molecular weight of 235.67 g/mol. IUPAC name: 5-(aminomethyl)-1-(2-methoxyethyl)pyrimidine-2,4-dione;hydrochloride. InChIKey: QDRLKSDJUMJPBS-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O3 |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 5-(aminomethyl)-1-(2-methoxyethyl)pyrimidine-2,4-dione;hydrochloride |
| InChIKey | QDRLKSDJUMJPBS-UHFFFAOYSA-N |
| SMILES | COCCN1C=C(C(=O)NC1=O)CN.Cl |
Computed by PubChem (NCBI)