cas: 1255574-69-6 — see every product listed under this CAS number, including other names
5-(Benzyloxy)-4-bromo-2-nitroaniline, 98% (CAS 1255574-69-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218690-250MG |
| cas | 1255574-69-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 1903.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-nitro-5-phenylmethoxyaniline (CAS 1255574-69-6) is a chemical compound with the molecular formula C13H11BrN2O3 and a molecular weight of 323.14 g/mol. IUPAC name: 4-bromo-2-nitro-5-phenylmethoxyaniline. InChIKey: DGOWGMXDNNTWKK-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O3 |
|---|---|
| Molecular weight | 323.14 g/mol |
| IUPAC name | 4-bromo-2-nitro-5-phenylmethoxyaniline |
| InChIKey | DGOWGMXDNNTWKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)