cas: 2096338-43-9 — see every product listed under this CAS number, including other names
5-(Cyclopropylaminomethyl)-2-fluorophenylboronic acid pinacol ester 97% (CAS 2096338-43-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A497291-250mg |
| cas | 2096338-43-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A497291 |
N-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine (CAS 2096338-43-9) is a chemical compound with the molecular formula C16H23BFNO2 and a molecular weight of 291.2 g/mol. IUPAC name: N-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine. InChIKey: SQQJLXGGSCDYOG-UHFFFAOYSA-N.
| Molecular formula | C16H23BFNO2 |
|---|---|
| Molecular weight | 291.2 g/mol |
| IUPAC name | N-[[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclopropanamine |
| InChIKey | SQQJLXGGSCDYOG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CNC3CC3)F |
Computed by PubChem (NCBI)