CAS 1423028-04-9 appears in our catalog under these names: 5-(Difluoromethyl)-1-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 5-(Difluoromethyl)-1-methyl-1H-1,2,3-triazole-4-carboxylic acid, 5-(Difluoromethyl)-1-methyl-1H-1,2,3-triazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 250mg, 1g, 50mg, 0,5g, 25mg, 100mg.
5-(difluoromethyl)-1-methyltriazole-4-carboxylic acid (CAS 1423028-04-9) is a chemical compound with the molecular formula C5H5F2N3O2 and a molecular weight of 177.11 g/mol. IUPAC name: 5-(difluoromethyl)-1-methyltriazole-4-carboxylic acid. InChIKey: RMZYHRQIGZSXQM-UHFFFAOYSA-N.
| Molecular formula | C5H5F2N3O2 |
|---|---|
| Molecular weight | 177.11 g/mol |
| IUPAC name | 5-(difluoromethyl)-1-methyltriazole-4-carboxylic acid |
| InChIKey | RMZYHRQIGZSXQM-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=N1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)