5-(Trifluoromethyl)-5H-thianthren-5-ium hexafluorophosphate(V), 95%
cas: 2828433-75-4 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)-5H-thianthren-5-ium hexafluorophosphate(V), 95% (CAS 2828433-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1503528-100mg |
| cas | 2828433-75-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 1455.06 Pln | |
| Ambeed | 10g | 2678.81 Pln | |
| Ambeed | 25g | 5487.88 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 669.79 Pln | |
| BLDpharm | 5g | 1430.63 Pln | |
| BLDpharm | 10g | 2624.66 Pln | |
| BLDpharm | 25g | 5384.80 Pln | |
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1302.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-(trifluoromethyl)thianthren-5-ium hexafluorophosphate (CAS 2828433-75-4) is a chemical compound with the molecular formula C13H8F9PS2 and a molecular weight of 430.3 g/mol. IUPAC name: 5-(trifluoromethyl)thianthren-5-ium hexafluorophosphate. InChIKey: QCHOZRBDMFJLOH-UHFFFAOYSA-N.
| Molecular formula | C13H8F9PS2 |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | 5-(trifluoromethyl)thianthren-5-ium hexafluorophosphate |
| InChIKey | QCHOZRBDMFJLOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)SC3=CC=CC=C3[S+]2C(F)(F)F.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)