5-(Trifluoromethyl)isophthalic acid, 98%
cas: 117186-03-5 — see every product listed under this CAS number, including other names
5-(Trifluoromethyl)isophthalic acid, 98% (CAS 117186-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F617467-100MG |
| cas | 117186-03-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 981.96 Pln | |
| Fluorochem | 5g | 3361.33 Pln | |
| Fluorochem | 10g | 6089.54 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
5-(trifluoromethyl)benzene-1,3-dicarboxylic acid (CAS 117186-03-5) is a chemical compound with the molecular formula C9H5F3O4 and a molecular weight of 234.13 g/mol. IUPAC name: 5-(trifluoromethyl)benzene-1,3-dicarboxylic acid. InChIKey: MFRAUNNXQCRKQI-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O4 |
|---|---|
| Molecular weight | 234.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)benzene-1,3-dicarboxylic acid |
| InChIKey | MFRAUNNXQCRKQI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)