CAS 107867-51-6 appears in our catalog under these names: 5-(Trifluoromethyl)pyridine-2,3-diamine, 98%, 5–(Trifluoromethyl)–2,3–Pyridinediamine, 5-(Trifluoromethyl)pyridine-2,3-diamine, 96%, 96%, 5-(Trifluoromethyl)pyridine-2,3-diamine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
5-(trifluoromethyl)pyridine-2,3-diamine (CAS 107867-51-6) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: 5-(trifluoromethyl)pyridine-2,3-diamine. InChIKey: RNSZENVDZWTPPG-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)pyridine-2,3-diamine |
| InChIKey | RNSZENVDZWTPPG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1N)N)C(F)(F)F |
Computed by PubChem (NCBI)