CAS 1303968-50-4 is the registry number for 5-(tert-Butyl)benzo[d]thiazol-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-tert-butyl-1,3-benzothiazol-2-amine (CAS 1303968-50-4) is a chemical compound with the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. IUPAC name: 5-tert-butyl-1,3-benzothiazol-2-amine. InChIKey: XPSGSWDTMNDZOC-UHFFFAOYSA-N.
| Molecular formula | C11H14N2S |
|---|---|
| Molecular weight | 206.31 g/mol |
| IUPAC name | 5-tert-butyl-1,3-benzothiazol-2-amine |
| InChIKey | XPSGSWDTMNDZOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)SC(=N2)N |
Computed by PubChem (NCBI)