cas: 1159408-54-4 — see every product listed under this CAS number, including other names
5-[[3,4,6-Tri-O-acetyl-2-(acetylamino)-2-deoxy-β-D-galactopyranosyl]oxy]pentanoic acid, 98%, 98% (CAS 1159408-54-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EAY0-25mg |
| cas | 1159408-54-4 |
| size | 25mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 83.60 Pln | |
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 500mg | 122.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 654.80 Pln | |
| Chemat | 25g | 1509.20 Pln | |
| Chemat | 50g | 2819.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoic acid (CAS 1159408-54-4) is a chemical compound with the molecular formula C19H29NO11 and a molecular weight of 447.4 g/mol. IUPAC name: 5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoic acid. InChIKey: CIMKBXFSXWOMDK-IQZDNPOKSA-N.
| Molecular formula | C19H29NO11 |
|---|---|
| Molecular weight | 447.4 g/mol |
| IUPAC name | 5-[(2R,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypentanoic acid |
| InChIKey | CIMKBXFSXWOMDK-IQZDNPOKSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OCCCCC(=O)O)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)