CAS 827026-60-8 appears in our catalog under these names: Acetazolamide EP Impurity E, Acetazolamide impurity 5. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
5-acetamido-1,3,4-thiadiazole-2-sulfonic acid (CAS 827026-60-8) is a chemical compound with the molecular formula C4H5N3O4S2 and a molecular weight of 223.2 g/mol. IUPAC name: 5-acetamido-1,3,4-thiadiazole-2-sulfonic acid. InChIKey: YLYWNBBQDHCLJL-UHFFFAOYSA-N.
| Molecular formula | C4H5N3O4S2 |
|---|---|
| Molecular weight | 223.2 g/mol |
| IUPAC name | 5-acetamido-1,3,4-thiadiazole-2-sulfonic acid |
| InChIKey | YLYWNBBQDHCLJL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NN=C(S1)S(=O)(=O)O |
Computed by PubChem (NCBI)