cas: 120068-79-3 — see every product listed under this CAS number, including other names
5-Amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile 95% (CAS 120068-79-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130060-5g |
| cas | 120068-79-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 170.12 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 909.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130060 |
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile (CAS 120068-79-3) is a chemical compound with the molecular formula C11H5Cl2F3N4 and a molecular weight of 321.08 g/mol. IUPAC name: 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile. InChIKey: QPZYPAMYHBOUTC-UHFFFAOYSA-N.
| Molecular formula | C11H5Cl2F3N4 |
|---|---|
| Molecular weight | 321.08 g/mol |
| IUPAC name | 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
| InChIKey | QPZYPAMYHBOUTC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N2C(=CC(=N2)C#N)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)