cas: 1373232-58-6 — see every product listed under this CAS number, including other names
5-Amino-3-(trifluoromethyl)pyridin-2(1H)-one, 97%, 97% (CAS 1373232-58-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11245N-100mg |
| cas | 1373232-58-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 971.60 Pln | |
| Chemat | 5g | 3338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-amino-3-(trifluoromethyl)-1H-pyridin-2-one (CAS 1373232-58-6) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 5-amino-3-(trifluoromethyl)-1H-pyridin-2-one. InChIKey: BPJZAXHGXOGOGS-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 5-amino-3-(trifluoromethyl)-1H-pyridin-2-one |
| InChIKey | BPJZAXHGXOGOGS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1N)C(F)(F)F |
Computed by PubChem (NCBI)