CAS 158205-19-7 appears in our catalog under these names: 5–Amino–6–bromo–2,3–dihydro–1H–inden–1–one, 5-Amino-6-bromo-2,3-dihydro-1H-inden-1-one, 96%, 96%, 5-Amino-6-bromo-2,3-dihydro-1H-inden-1-one, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g, 10g.
5-amino-6-bromo-2,3-dihydroinden-1-one (CAS 158205-19-7) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 5-amino-6-bromo-2,3-dihydroinden-1-one. InChIKey: CCOFLYKTUCBGSG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 5-amino-6-bromo-2,3-dihydroinden-1-one |
| InChIKey | CCOFLYKTUCBGSG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)N)Br |
Computed by PubChem (NCBI)