cas: 1246471-43-1 — see every product listed under this CAS number, including other names
5-BOC-2-(METHYLTHIO)-5,6,7,8-TETRAHYDROPYRIDO[3,2-D]PYRIMIDINE (CAS 1246471-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387400-100MG |
| cas | 1246471-43-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1768.15 Pln | |
| Fluorochem | 250mg | 2075.33 Pln | |
| Fluorochem | 1g | 7214.14 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2-methylsulfanyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate (CAS 1246471-43-1) is a chemical compound with the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. IUPAC name: tert-butyl 2-methylsulfanyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate. InChIKey: WTQQJKUBDRUCJD-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O2S |
|---|---|
| Molecular weight | 281.38 g/mol |
| IUPAC name | tert-butyl 2-methylsulfanyl-7,8-dihydro-6H-pyrido[3,2-d]pyrimidine-5-carboxylate |
| InChIKey | WTQQJKUBDRUCJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=NC(=NC=C21)SC |
Computed by PubChem (NCBI)