cas: 946700-34-1 — see every product listed under this CAS number, including other names
5-BROMO-2-[4-(TERT-BUTYL)PHENOXY]ANILINE, 95%, 95% (CAS 946700-34-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EB4V-250mg |
| cas | 946700-34-1 |
| size | 250mg |
| availability | 14.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1163.60 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 10g | 5022.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-(4-tert-butylphenoxy)aniline (CAS 946700-34-1) is a chemical compound with the molecular formula C16H18BrNO and a molecular weight of 320.22 g/mol. IUPAC name: 5-bromo-2-(4-tert-butylphenoxy)aniline. InChIKey: YIOGUXOWOUMLHU-UHFFFAOYSA-N.
| Molecular formula | C16H18BrNO |
|---|---|
| Molecular weight | 320.22 g/mol |
| IUPAC name | 5-bromo-2-(4-tert-butylphenoxy)aniline |
| InChIKey | YIOGUXOWOUMLHU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2=C(C=C(C=C2)Br)N |
Computed by PubChem (NCBI)