cas: 1198096-48-8 — see every product listed under this CAS number, including other names
5-BROMO-7-CHLORO-1H-PYRROLO[2,3-C]PYRIDINE, 96% (CAS 1198096-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305379-100MG |
| cas | 1198096-48-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1158.98 Pln | |
| Fluorochem | 250mg | 2247.14 Pln | |
| Fluorochem | 1g | 5532.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine (CAS 1198096-48-8) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine. InChIKey: LHURNXZTMAOLSE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 5-bromo-7-chloro-1H-pyrrolo[2,3-c]pyridine |
| InChIKey | LHURNXZTMAOLSE-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(N=C(C=C21)Br)Cl |
Computed by PubChem (NCBI)