cas: 2436-15-9 — see every product listed under this CAS number, including other names
5-Benzoloxy-3-indoleacetonitrile, ≥97%, ≥97% (CAS 2436-15-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EXO-1g |
| cas | 2436-15-9 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 25g | 2512.40 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(5-phenylmethoxy-1H-indol-3-yl)acetonitrile (CAS 2436-15-9) is a chemical compound with the molecular formula C17H14N2O and a molecular weight of 262.30 g/mol. IUPAC name: 2-(5-phenylmethoxy-1H-indol-3-yl)acetonitrile. InChIKey: ADPRFNVFBYHCJQ-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | 2-(5-phenylmethoxy-1H-indol-3-yl)acetonitrile |
| InChIKey | ADPRFNVFBYHCJQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3CC#N |
Computed by PubChem (NCBI)