cas: 17671-75-9 — see every product listed under this CAS number, including other names
5-Benzyloxy-2-bromotoluene, 98% (CAS 17671-75-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011447-1G |
| cas | 17671-75-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 945.52 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98% |
1-bromo-2-methyl-4-phenylmethoxybenzene (CAS 17671-75-9) is a chemical compound with the molecular formula C14H13BrO and a molecular weight of 277.16 g/mol. IUPAC name: 1-bromo-2-methyl-4-phenylmethoxybenzene. InChIKey: KOLLVAZFQFRSHI-UHFFFAOYSA-N.
| Molecular formula | C14H13BrO |
|---|---|
| Molecular weight | 277.16 g/mol |
| IUPAC name | 1-bromo-2-methyl-4-phenylmethoxybenzene |
| InChIKey | KOLLVAZFQFRSHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)