5-Benzyloxyindole, 95%
cas: 1215-59-4 — see every product listed under this CAS number, including other names
5-Benzyloxyindole, 95% (CAS 1215-59-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 250g, 500g. Offered by: Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 106090050 |
| cas | 1215-59-4 |
| size | 5g |
| availability | availability |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 187.53 Pln | |
| Thermo Scientific (Acros) | 25g | 628.08 Pln | |
| Sigma-Aldrich | 25G | 424.00 Pln | |
| Sigma-Aldrich | 5G | 169.00 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1148.57 Pln | |
| Fluorochem | 250g | 2762.59 Pln | |
| Fluorochem | 500g | 4215.20 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
5-phenylmethoxy-1H-indole (CAS 1215-59-4) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 5-phenylmethoxy-1H-indole. InChIKey: JCQLPDZCNSVBMS-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 5-phenylmethoxy-1H-indole |
| InChIKey | JCQLPDZCNSVBMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)