cas: 1133116-33-2 — see every product listed under this CAS number, including other names
5-Bromo-1,3-dichloro-2-isopropoxybenzene (CAS 1133116-33-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329277-5G |
| cas | 1133116-33-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1955.58 Pln | |
| Fluorochem | 10g | 3278.03 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-1,3-dichloro-2-propan-2-yloxybenzene (CAS 1133116-33-2) is a chemical compound with the molecular formula C9H9BrCl2O and a molecular weight of 283.97 g/mol. IUPAC name: 5-bromo-1,3-dichloro-2-propan-2-yloxybenzene. InChIKey: LUNWKSQFHLDZOY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrCl2O |
|---|---|
| Molecular weight | 283.97 g/mol |
| IUPAC name | 5-bromo-1,3-dichloro-2-propan-2-yloxybenzene |
| InChIKey | LUNWKSQFHLDZOY-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)