cas: 1137869-91-0 — see every product listed under this CAS number, including other names
5-Bromo-1-fluoro-3-methoxy-2-nitrobenzene, 95%, 95% (CAS 1137869-91-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1110NS-10g |
| cas | 1137869-91-0 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1950.80 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1106.00 Pln | |
| Chemat | 25g | 4293.20 Pln | |
| Chemat | 100g | 14334.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-1-fluoro-3-methoxy-2-nitrobenzene (CAS 1137869-91-0) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene. InChIKey: BLGZBPZOEMCFOM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 5-bromo-1-fluoro-3-methoxy-2-nitrobenzene |
| InChIKey | BLGZBPZOEMCFOM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)