5-Bromo-2,3,3-trimethyl-3H-indole, 97%
cas: 54136-24-2 — see every product listed under this CAS number, including other names
5-Bromo-2,3,3-trimethyl-3H-indole, 97% (CAS 54136-24-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F606076-1G |
| cas | 54136-24-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 325.94 Pln | |
| Fluorochem | 25g | 700.81 Pln | |
| Fluorochem | 100g | 2044.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2,3,3-trimethylindole (CAS 54136-24-2) is a chemical compound with the molecular formula C11H12BrN and a molecular weight of 238.12 g/mol. IUPAC name: 5-bromo-2,3,3-trimethylindole. InChIKey: OUWLZEOAVCFTAQ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 5-bromo-2,3,3-trimethylindole |
| InChIKey | OUWLZEOAVCFTAQ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C1(C)C)C=C(C=C2)Br |
Computed by PubChem (NCBI)