cas: 7355-22-8 — see every product listed under this CAS number, including other names
5-Bromo-2,4-Dihydroxybenzoic Acid, 97%, 97% (CAS 7355-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MGJ-1g |
| cas | 7355-22-8 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 222.80 Pln | |
| Chemat | 25g | 746.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2,4-dihydroxybenzoic acid (CAS 7355-22-8) is a chemical compound with the molecular formula C7H5BrO4 and a molecular weight of 233.02 g/mol. IUPAC name: 5-bromo-2,4-dihydroxybenzoic acid. InChIKey: ZRBCISXJLHZOMS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO4 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 5-bromo-2,4-dihydroxybenzoic acid |
| InChIKey | ZRBCISXJLHZOMS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)O)O)C(=O)O |
Computed by PubChem (NCBI)