cas: 24255-95-6 — see every product listed under this CAS number, including other names
5-Bromo-2-(Piperidin-1-Yl)Pyridine (CAS 24255-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFKZ-1g |
| cas | 24255-95-6 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1043.60 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 2955.23 Pln |
| delivery time | 3 weeks |
|---|
5-bromo-2-piperidin-1-ylpyridine (CAS 24255-95-6) is a chemical compound with the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. IUPAC name: 5-bromo-2-piperidin-1-ylpyridine. InChIKey: AEDSMUUEBQNEAA-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN2 |
|---|---|
| Molecular weight | 241.13 g/mol |
| IUPAC name | 5-bromo-2-piperidin-1-ylpyridine |
| InChIKey | AEDSMUUEBQNEAA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)