cas: 1048963-39-8 — see every product listed under this CAS number, including other names
5-Bromo-2-(trifluoromethoxy)phenol 98% (CAS 1048963-39-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270361-500g |
| cas | 1048963-39-8 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 14632.62 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1288.19 Pln | |
| Ambeed | 100g | 3524.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270361 |
5-bromo-2-(trifluoromethoxy)phenol (CAS 1048963-39-8) is a chemical compound with the molecular formula C7H4BrF3O2 and a molecular weight of 257.00 g/mol. IUPAC name: 5-bromo-2-(trifluoromethoxy)phenol. InChIKey: GJWAGGWLHRHYOE-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2 |
|---|---|
| Molecular weight | 257.00 g/mol |
| IUPAC name | 5-bromo-2-(trifluoromethoxy)phenol |
| InChIKey | GJWAGGWLHRHYOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)O)OC(F)(F)F |
Computed by PubChem (NCBI)