cas: 612845-46-2 — see every product listed under this CAS number, including other names
5-Bromo-2-ethoxypyridine-4-boronic acid, 98%, 98% (CAS 612845-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BXO-250mg |
| cas | 612845-46-2 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1384.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(5-bromo-2-ethoxy-4-pyridinyl)boronic acid (CAS 612845-46-2) is a chemical compound with the molecular formula C7H9BBrNO3 and a molecular weight of 245.87 g/mol. IUPAC name: (5-bromo-2-ethoxy-4-pyridinyl)boronic acid. InChIKey: RLPXRCAGOQMYBN-UHFFFAOYSA-N.
| Molecular formula | C7H9BBrNO3 |
|---|---|
| Molecular weight | 245.87 g/mol |
| IUPAC name | (5-bromo-2-ethoxy-4-pyridinyl)boronic acid |
| InChIKey | RLPXRCAGOQMYBN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1Br)OCC)(O)O |
Computed by PubChem (NCBI)