cas: 1373233-07-8 — see every product listed under this CAS number, including other names
5-Bromo-2-iodo-4-(trifluoromethyl)aniline, >95%, >95% (CAS 1373233-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HUWO-100mg |
| cas | 1373233-07-8 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 2373.20 Pln | |
| Chemat | 5g | 6678.80 Pln | |
| Chemat | 10g | 9712.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-iodo-4-(trifluoromethyl)aniline (CAS 1373233-07-8) is a chemical compound with the molecular formula C7H4BrF3IN and a molecular weight of 365.92 g/mol. IUPAC name: 5-bromo-2-iodo-4-(trifluoromethyl)aniline. InChIKey: XBTXLOYTLZINLR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3IN |
|---|---|
| Molecular weight | 365.92 g/mol |
| IUPAC name | 5-bromo-2-iodo-4-(trifluoromethyl)aniline |
| InChIKey | XBTXLOYTLZINLR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)