cas: 871571-19-6 — see every product listed under this CAS number, including other names
5-Bromo-2-methoxyphenyl methanesulfonate, 98% (CAS 871571-19-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A310261-5g |
| cas | 871571-19-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 200.20 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(5-bromo-2-methoxyphenyl) methanesulfonate (CAS 871571-19-6) is a chemical compound with the molecular formula C8H9BrO4S and a molecular weight of 281.13 g/mol. IUPAC name: (5-bromo-2-methoxyphenyl) methanesulfonate. InChIKey: GNSGHHSZKANUDW-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO4S |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | (5-bromo-2-methoxyphenyl) methanesulfonate |
| InChIKey | GNSGHHSZKANUDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)OS(=O)(=O)C |
Computed by PubChem (NCBI)