cas: 1033202-50-4 — see every product listed under this CAS number, including other names
5-Bromo-3-nitro-N-propylpyridin-2-amine, 98% (CAS 1033202-50-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A573616-500g |
| cas | 1033202-50-4 |
| size | 500g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 8244.48 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 278.32 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-3-nitro-N-propylpyridin-2-amine (CAS 1033202-50-4) is a chemical compound with the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. IUPAC name: 5-bromo-3-nitro-N-propylpyridin-2-amine. InChIKey: ZBSFLRGZSROPER-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O2 |
|---|---|
| Molecular weight | 260.09 g/mol |
| IUPAC name | 5-bromo-3-nitro-N-propylpyridin-2-amine |
| InChIKey | ZBSFLRGZSROPER-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=C(C=N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)