CAS 1082041-90-4 is the registry number for 5-Bromo-4-chloro-1H-indazole, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
5-bromo-4-chloro-1H-indazole (CAS 1082041-90-4) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 5-bromo-4-chloro-1H-indazole. InChIKey: GMGRNRQBEWCLKJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 5-bromo-4-chloro-1H-indazole |
| InChIKey | GMGRNRQBEWCLKJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2)Cl)Br |
Computed by PubChem (NCBI)