cas: 17016-46-5 — see every product listed under this CAS number, including other names
5-Bromo-4-chloro-3-indolyl β-D-fucopyranoside 95+% (CAS 17016-46-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A315090-5mg |
| cas | 17016-46-5 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 592.88 Pln | |
| Ambeed | 10mg | 1037.88 Pln | |
| Ambeed | 25mg | 2011.31 Pln | |
| Ambeed | 50mg | 3062.62 Pln | |
| Ambeed | 100mg | 5309.88 Pln | |
| Ambeed | 250mg | 10544.19 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A315090 |
(2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-methyloxane-3,4,5-triol (CAS 17016-46-5) is a chemical compound with the molecular formula C14H15BrClNO5 and a molecular weight of 392.63 g/mol. IUPAC name: (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-methyloxane-3,4,5-triol. InChIKey: ZMYJTGDNFZJYFN-MFWXUWBHSA-N.
| Molecular formula | C14H15BrClNO5 |
|---|---|
| Molecular weight | 392.63 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-methyloxane-3,4,5-triol |
| InChIKey | ZMYJTGDNFZJYFN-MFWXUWBHSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |
Computed by PubChem (NCBI)